GOL
GLYCEROL
Find entries where: GOL
is present as a standalone ligand in 23,266 entries
as a non-polymer is covalently linked to polymer or other heterogen groups 113 entries
Find related ligands:
Chemical Component Summary | |
|---|---|
| Name | GLYCEROL |
| Synonyms | GLYCERIN; PROPANE-1,2,3-TRIOL |
| Identifiers | propane-1,2,3-triol |
| Formula | C3 H8 O3 |
| Molecular Weight | 92.094 |
| Type | NON-POLYMER |
| Isomeric SMILES | C(C(CO)O)O |
| InChI | InChI=1S/C3H8O3/c4-1-3(6)2-5/h3-6H,1-2H2 |
| InChIKey | PEDCQBHIVMGVHV-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 14 |
| Chiral Atom Count | 0 |
| Bond Count | 13 |
| Aromatic Bond Count | 0 |
Drug Info: DrugBank
| DrugBank ID | DB09462 |
|---|---|
| Name | Glycerin |
| Groups |
|
| Description | A trihydroxy sugar alcohol that is an intermediate in carbohydrate and lipid metabolism. |
| Synonyms |
|
| Brand Names |
|
| Indication | It is used as a solvent, emollient, pharmaceutical agent, and sweetening agent. |
| Categories |
|
| ATC-Code |
|
| CAS number | 56-81-5 |
Drug Targets
Drug Info/Drug Targets: DrugBank 3.0: a comprehensive resource for 'omics' research on drugs. Knox C, Law V, Jewison
T, Liu P, Ly S, Frolkis A, Pon A, Banco K, Mak C, Neveu V, Djoumbou Y, Eisner R, Guo AC, Wishart DS.
Nucleic Acids Res. 2011 Jan; 39 (Database issue):D1035-41. | PMID:21059682
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 753 |
| ChEMBL | CHEMBL692 |
| ChEBI | CHEBI:17754, CHEBI:17522 |
| CCDC/CSD | GLCROL01 |












